Products 19779-75-0

CAS 19779-75-0 is the registry number for D,L-Tryptophan Methyl Ester Benzaldimine. Offered by: TRC. Available pack sizes: 10g, 2g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-(benzylideneamino)-3-(1H-indol-3-yl)propanoate (CAS 19779-75-0) is a chemical compound with the molecular formula C19H18N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: methyl 2-(benzylideneamino)-3-(1H-indol-3-yl)propanoate. InChIKey: LFMPJRXYSNSSJV-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18N2O2
Molecular weight306.4 g/mol
IUPAC namemethyl 2-(benzylideneamino)-3-(1H-indol-3-yl)propanoate
InChIKeyLFMPJRXYSNSSJV-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1=CNC2=CC=CC=C21)N=CC3=CC=CC=C3

Computed by PubChem (NCBI)