Products 838584-50-2

CAS 838584-50-2 is the registry number for 5-((3-Formyl-1H-indol-1-yl)methyl)furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

5-[(3-formylindol-1-yl)methyl]furan-2-carboxylic acid (CAS 838584-50-2) is a chemical compound with the molecular formula C15H11NO4 and a molecular weight of 269.25 g/mol. IUPAC name: 5-[(3-formylindol-1-yl)methyl]furan-2-carboxylic acid. InChIKey: DAYGBDYALIOMSM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11NO4
Molecular weight269.25 g/mol
IUPAC name5-[(3-formylindol-1-yl)methyl]furan-2-carboxylic acid
InChIKeyDAYGBDYALIOMSM-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CN2CC3=CC=C(O3)C(=O)O)C=O

Computed by PubChem (NCBI)