Products 1980048-81-4
CAS 1980048-81-4 appears in our catalog under these names: 4-azaspiro(2.3)hexane hemioxalate, 97%, 4–azaspiro(2·3)hexane hemioxalate. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 100mg.
Bis(4-azaspiro[2.3]hexane);oxalic acid (CAS 1980048-81-4) is a chemical compound with the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. IUPAC name: bis(4-azaspiro[2.3]hexane);oxalic acid. InChIKey: AOSPRPAGKLZFHS-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O4 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | bis(4-azaspiro[2.3]hexane);oxalic acid |
| InChIKey | AOSPRPAGKLZFHS-UHFFFAOYSA-N |
| SMILES | C1CC12CCN2.C1CC12CCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)