CAS 1980050-06-3 appears in our catalog under these names: 6-Ethoxy-2,3,4-trifluorobenzoic acid, 95%, 6-Ethoxy-2,3,4-trifluorobenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-ethoxy-2,3,4-trifluorobenzoic acid (CAS 1980050-06-3) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 6-ethoxy-2,3,4-trifluorobenzoic acid. InChIKey: WXQFZTJBUORIBQ-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 6-ethoxy-2,3,4-trifluorobenzoic acid |
| InChIKey | WXQFZTJBUORIBQ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C(=C1C(=O)O)F)F)F |
Computed by PubChem (NCBI)