Products 19806-14-5
CAS 19806-14-5 appears in our catalog under these names: Biphenyl–4，4'–diacetic acid, Biphenyl-4,4'-diacetic acid 95%, Biphenyl-4,4'-diacetic acid, 95%, 95%, BIPHENYL-4,4'-DIACETIC ACID, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-[4-[4-(carboxymethyl)phenyl]phenyl]acetic acid (CAS 19806-14-5) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 2-[4-[4-(carboxymethyl)phenyl]phenyl]acetic acid. InChIKey: CXLNWJSKZPSWPR-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 2-[4-[4-(carboxymethyl)phenyl]phenyl]acetic acid |
| InChIKey | CXLNWJSKZPSWPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)C2=CC=C(C=C2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Biphenyl-4,4'-diacetic acid, 4,4'-Biphenyldiacetic acid, [1,1'-Biphenyl]-4,4'-diacetic acid, 2-[4-[4-(carboxymethyl)phenyl]phenyl]acetic acid, 2,2'-([1,1'-Biphenyl]-4,4'-diyl)diacetic acid, Fenbufen Impurity 17, p,p'-Biphenyldiacetic acid, Biphenyl-4,4'-diaceticacid, Biphenyl-44'-diacetic acid, 2-[4-[4-(carboxymethyl)-phenyl]-phenyl]-acetic acid