Products 198220-53-0

CAS 198220-53-0 is the registry number for 4-((2,6-Dimethylphenyl)amino)-4-oxobut-2-enoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoic acid (CAS 198220-53-0) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoic acid. InChIKey: BDIUUKLMBSBKIT-VOTSOKGWSA-N.

Identity
Molecular formulaC12H13NO3
Molecular weight219.24 g/mol
IUPAC name(E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoic acid
InChIKeyBDIUUKLMBSBKIT-VOTSOKGWSA-N
SMILESCC1=C(C(=CC=C1)C)NC(=O)/C=C/C(=O)O

Computed by PubChem (NCBI)