CAS 31460-31-8 is the registry number for 4-(2,6-Dimethylanilino)-4-oxobut-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoic acid (CAS 31460-31-8) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoic acid. InChIKey: BDIUUKLMBSBKIT-VOTSOKGWSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | (E)-4-(2,6-dimethylanilino)-4-oxobut-2-enoic acid |
| InChIKey | BDIUUKLMBSBKIT-VOTSOKGWSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)