Products 198284-10-5

CAS 198284-10-5 is the registry number for Phthalic Acid 1-(1,2-dimethylpropyl) Ester. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(3-methylbutan-2-yloxycarbonyl)benzoic acid (CAS 198284-10-5) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 2-(3-methylbutan-2-yloxycarbonyl)benzoic acid. InChIKey: AJRMLQSJNSDUHW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O4
Molecular weight236.26 g/mol
IUPAC name2-(3-methylbutan-2-yloxycarbonyl)benzoic acid
InChIKeyAJRMLQSJNSDUHW-UHFFFAOYSA-N
SMILESCC(C)C(C)OC(=O)C1=CC=CC=C1C(=O)O

Computed by PubChem (NCBI)