CAS 198419-91-9 appears in our catalog under these names: LY 367385, LY367385, LY 367385, LY367385, 99.0%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 500mg, 10mg, 50mg, 100mg, 5mg, 1 mg.
4-[(S)-amino(carboxy)methyl]-3-methylbenzoic acid (CAS 198419-91-9) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 4-[(S)-amino(carboxy)methyl]-3-methylbenzoic acid. InChIKey: SGIKDIUCJAUSRD-QMMMGPOBSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 4-[(S)-amino(carboxy)methyl]-3-methylbenzoic acid |
| InChIKey | SGIKDIUCJAUSRD-QMMMGPOBSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)