Products 1986-00-1
CAS 1986-00-1 is the registry number for 4-Hydroxy-9H-fluoren-9-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-hydroxyfluoren-9-one (CAS 1986-00-1) is a chemical compound with the molecular formula C13H8O2 and a molecular weight of 196.20 g/mol. IUPAC name: 4-hydroxyfluoren-9-one. InChIKey: OZLKIIAMQWXVKQ-UHFFFAOYSA-N.
| Molecular formula | C13H8O2 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 4-hydroxyfluoren-9-one |
| InChIKey | OZLKIIAMQWXVKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C2=O)C=CC=C3O |
Computed by PubChem (NCBI)
Synonyms:
4-Hydroxy-9-fluorenone, 4-Hydroxy-9H-fluoren-9-one, 9H-Fluoren-9-one, 4-hydroxy-, 4-08-00-01384 (Beilstein Handbook Reference), 9H-Fluoren-9-one, 4-hydroxy-(9CI), 2-Hydroxy-9-fluorenone, 4-hydroxyfluoren-9-one, 4-hydroxy-fluoren-9-one, 4-Hydroxy-9-fluorenone, 98%, OZLKIIAMQWXVKQ-UHFFFAOYSA-