CAS 1987412-64-5 is the registry number for rac-tert-Butyl (3R,4R)-4-(difluoromethyl)pyrrolidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl (3S,4S)-4-(difluoromethyl)pyrrolidine-3-carboxylate (CAS 1987412-64-5) is a chemical compound with the molecular formula C10H17F2NO2 and a molecular weight of 221.24 g/mol. IUPAC name: tert-butyl (3S,4S)-4-(difluoromethyl)pyrrolidine-3-carboxylate. InChIKey: NELXAXGZHDIZMC-RNFRBKRXSA-N.
| Molecular formula | C10H17F2NO2 |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | tert-butyl (3S,4S)-4-(difluoromethyl)pyrrolidine-3-carboxylate |
| InChIKey | NELXAXGZHDIZMC-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CNC[C@H]1C(F)F |
Computed by PubChem (NCBI)