CAS 1989-53-3 appears in our catalog under these names: 2,6-Dimethoxybenzoyl chloride, tech grade, 80%, 2,6-Dimethoxybenzoyl Chloride. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 25g, 5g, 10g, 50g, 2g.
2,6-dimethoxybenzoyl chloride (CAS 1989-53-3) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 2,6-dimethoxybenzoyl chloride. InChIKey: NDXRPDJVAUCBOH-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 2,6-dimethoxybenzoyl chloride |
| InChIKey | NDXRPDJVAUCBOH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)C(=O)Cl |
Computed by PubChem (NCBI)