CAS 1989672-88-9 appears in our catalog under these names: 1,2,3,4-Tetrahydronaphthalene-1,8-diamine dihydrochloride, 95%, 1,2,3,4-Tetrahydronaphthalene-1,8-diamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,2,3,4-tetrahydronaphthalene-1,8-diamine;dihydrochloride (CAS 1989672-88-9) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 1,2,3,4-tetrahydronaphthalene-1,8-diamine;dihydrochloride. InChIKey: VVGYHYFNFOUQOY-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 1,2,3,4-tetrahydronaphthalene-1,8-diamine;dihydrochloride |
| InChIKey | VVGYHYFNFOUQOY-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C=CC=C2N)N.Cl.Cl |
Computed by PubChem (NCBI)