CAS 19912-61-9 appears in our catalog under these names: Furanodiene, Furanodiene/ 98%, Furanodiene, 99.83%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 20mg, 1mg, 5mg, 100mg, 200mg, 5 mg, 10 mg.
(5E,9Z)-3,6,10-trimethyl-4,7,8,11-tetrahydrocyclodeca[b]furan (CAS 19912-61-9) is a chemical compound with the molecular formula C15H20O and a molecular weight of 216.32 g/mol. IUPAC name: (5E,9Z)-3,6,10-trimethyl-4,7,8,11-tetrahydrocyclodeca[b]furan. InChIKey: VMDXHYHOJPKFEK-RZWYOFBOSA-N.
| Molecular formula | C15H20O |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | (5E,9Z)-3,6,10-trimethyl-4,7,8,11-tetrahydrocyclodeca[b]furan |
| InChIKey | VMDXHYHOJPKFEK-RZWYOFBOSA-N |
| SMILES | C/C/1=C\CC2=C(C/C(=C\CC1)/C)OC=C2C |
Computed by PubChem (NCBI)