Products 19926-50-2
CAS 19926-50-2 appears in our catalog under these names: Ethyl biphenyl-3-carboxylate, 97%, Ethyl [1,1'-biphenyl]-3-carboxylate, 95%, Biphenyl-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g, 50g.
Ethyl 3-phenylbenzoate (CAS 19926-50-2) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: ethyl 3-phenylbenzoate. InChIKey: UWJOIAKPUPVYPW-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | ethyl 3-phenylbenzoate |
| InChIKey | UWJOIAKPUPVYPW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=CC(=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
ethyl [1,1'-biphenyl]-3-carboxylate, ethyl biphenyl-3-carboxylate, ethyl 3-phenylbenzoate, Biphenyl-3-carboxylic acid ethyl ester, 3-Biphenylcarboxylic acid ethyl ester, [1,1'-Biphenyl]-3-carboxylic acid, ethyl ester, ethyl 3-biphenylcarboxylate, Ethyl[1,1'-biphenyl]-3-carboxylate, 3-Biphenylcarboxylic acid ethyl ester, AldrichCPR, biphenyl-3-carboxylic acid ethyl ester 19926-50-2