Products 1993278-46-8
CAS 1993278-46-8 is the registry number for (2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(isoquinolin-5-yl)propanoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-isoquinolin-5-ylpropanoic acid (CAS 1993278-46-8) is a chemical compound with the molecular formula C27H22N2O4 and a molecular weight of 438.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-isoquinolin-5-ylpropanoic acid. InChIKey: SJZPISYONDNICQ-RUZDIDTESA-N.
| Molecular formula | C27H22N2O4 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-isoquinolin-5-ylpropanoic acid |
| InChIKey | SJZPISYONDNICQ-RUZDIDTESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC=CC5=C4C=CN=C5)C(=O)O |
Computed by PubChem (NCBI)