CAS 199330-64-8 appears in our catalog under these names: Methyl 2–amino–2,3–dihydro–1H–indene–2–carboxylate hydrochloride, Methyl 2-amino-2,3-dihydro-1H-indene-2-carboxylate hydrochloride, 95%, 95%, Methyl 2-amino-2,3-dihydro-1H-indene-2-carboxylate hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 1g, 25g, 5g, 100mg, 250mg.
Methyl 2-amino-1,3-dihydroindene-2-carboxylate;hydrochloride (CAS 199330-64-8) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 2-amino-1,3-dihydroindene-2-carboxylate;hydrochloride. InChIKey: CTMQYQHFQQHLBO-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 2-amino-1,3-dihydroindene-2-carboxylate;hydrochloride |
| InChIKey | CTMQYQHFQQHLBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC2=CC=CC=C2C1)N.Cl |
Computed by PubChem (NCBI)