Products 1994299-33-0
CAS 1994299-33-0 is the registry number for L-Serine-13C3,15N,d3, 99.90%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg.
(2S)-2-(15N)azanyl-2,3,3-trideuterio-3-hydroxy(1,2,3-13C3)propanoic acid (CAS 1994299-33-0) is a chemical compound with the molecular formula C3H7NO3 and a molecular weight of 112.083 g/mol. IUPAC name: (2S)-2-(15N)azanyl-2,3,3-trideuterio-3-hydroxy(1,2,3-13C3)propanoic acid. InChIKey: MTCFGRXMJLQNBG-UXVMDEDXSA-N.
| Molecular formula | C3H7NO3 |
|---|---|
| Molecular weight | 112.083 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-2,3,3-trideuterio-3-hydroxy(1,2,3-13C3)propanoic acid |
| InChIKey | MTCFGRXMJLQNBG-UXVMDEDXSA-N |
| SMILES | [2H][13C@@]([13C](=O)O)([13C]([2H])([2H])O)[15NH2] |
Computed by PubChem (NCBI)