CAS 19946-44-2 appears in our catalog under these names: Cis-n-cbz-3-aminocyclopentanecarboxylic acid, 95%, cis-N-Cbz-3-aminocyclopentanecarboxylic Acid, 97%, cis-N-Cbz-3-aminocyclopentanecarboxylic Acid, cis-N-Cbz-3-aminocyclopentanecarboxylic Acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 2,5g, 500mg, 10g, 25g.
Cis-(1R,3S)-3-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid (CAS 19946-44-2) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: cis-(1R,3S)-3-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid. InChIKey: DEHMZYGMZLWARX-NEPJUHHUSA-N.
| Molecular formula | C14H17NO4 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | cis-(1R,3S)-3-(phenylmethoxycarbonylamino)cyclopentane-1-carboxylic acid |
| InChIKey | DEHMZYGMZLWARX-NEPJUHHUSA-N |
| SMILES | C1C[C@@H](C[C@@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)