CAS 19953-58-3 appears in our catalog under these names: Cla, 95%, CLA, CLA [Chemiluminescence Reagent], >98.0%(HPLC), 2-methyl-6-phenyl-3H,7H-imidazo[1,2-a]pyrazin-3-one, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, Get quote.
2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol (CAS 19953-58-3) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol. InChIKey: CZFAZZHPAZFANU-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 2-methyl-6-phenylimidazo[1,2-a]pyrazin-3-ol |
| InChIKey | CZFAZZHPAZFANU-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=C(N=CC2=N1)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)