CAS 199586-60-2 is the registry number for (6-Methoxy-2,2-dimethyl-3,4-dihydro-2h-chromen-4-yl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride (CAS 199586-60-2) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: 6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride. InChIKey: FYXPWIUHWKJSSP-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | 6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
| InChIKey | FYXPWIUHWKJSSP-UHFFFAOYSA-N |
| SMILES | CC1(CC(C2=C(O1)C=CC(=C2)OC)N)C.Cl |
Computed by PubChem (NCBI)