CAS 705250-98-2 is the registry number for Trans-2-[3-(trifluoromethyl)phenyl]cyclopropan-1-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropan-1-amine (CAS 705250-98-2) is a chemical compound with the molecular formula C10H10F3N and a molecular weight of 201.19 g/mol. IUPAC name: trans-(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropan-1-amine. InChIKey: IJUBEDIWPVVNLP-DTWKUNHWSA-N.
| Molecular formula | C10H10F3N |
|---|---|
| Molecular weight | 201.19 g/mol |
| IUPAC name | trans-(1R,2S)-2-[3-(trifluoromethyl)phenyl]cyclopropan-1-amine |
| InChIKey | IJUBEDIWPVVNLP-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)