CAS 199679-35-1 appears in our catalog under these names: (E)–3–(4–(Trifluoromethoxy)phenyl)acrylic acid, 3-(4-(Trifluoromethoxy)phenyl)prop-2-enoic acid, (E)-3-(4-(Trifluoromethoxy)phenyl)acrylic acid 95%, (E)-3-(4-(Trifluoromethoxy)phenyl)acrylic acid, 98%, 98%, 3-(4-(Trifluoromethoxy)phenyl)acrylic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
(E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoic acid (CAS 199679-35-1) is a chemical compound with the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. IUPAC name: (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoic acid. InChIKey: RNYVTJANWYBGPW-ZZXKWVIFSA-N.
| Molecular formula | C10H7F3O3 |
|---|---|
| Molecular weight | 232.16 g/mol |
| IUPAC name | (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoic acid |
| InChIKey | RNYVTJANWYBGPW-ZZXKWVIFSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)