CAS 1999-98-0 appears in our catalog under these names: 2-Ethyl-1-naphthoic acid, 98%, 2-Ethyl-1-naphthoic acid, 97%, 97%, 2-ethylnaphthalene-1-carboxylic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2-ethylnaphthalene-1-carboxylic acid (CAS 1999-98-0) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2-ethylnaphthalene-1-carboxylic acid. InChIKey: MRDQZUZLQVBBRM-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-ethylnaphthalene-1-carboxylic acid |
| InChIKey | MRDQZUZLQVBBRM-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC=CC=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)