CAS 19997-50-3 is the registry number for 2-(Bromomethyl)-5-chloro-2,3-dihydrobenzofuran, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(bromomethyl)-5-chloro-2,3-dihydro-1-benzofuran (CAS 19997-50-3) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 2-(bromomethyl)-5-chloro-2,3-dihydro-1-benzofuran. InChIKey: QNHKVVDYBAZLER-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 2-(bromomethyl)-5-chloro-2,3-dihydro-1-benzofuran |
| InChIKey | QNHKVVDYBAZLER-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C1C=C(C=C2)Cl)CBr |
Computed by PubChem (NCBI)