Products 200112-56-7
CAS 200112-56-7 is the registry number for Benzyl (R)-2-cyclopentyl-2-hydroxyacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2R)-2-cyclopentyl-2-hydroxyacetate (CAS 200112-56-7) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl (2R)-2-cyclopentyl-2-hydroxyacetate. InChIKey: SHFDGTCGWUQUFU-CYBMUJFWSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl (2R)-2-cyclopentyl-2-hydroxyacetate |
| InChIKey | SHFDGTCGWUQUFU-CYBMUJFWSA-N |
| SMILES | C1CCC(C1)[C@H](C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)