CAS 20041-61-6 appears in our catalog under these names: Entacapone Impurity 91, 2-Hydroxy-3-methoxy-4-nitrobenzaldehyde. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1g, 100mg.
2-hydroxy-3-methoxy-4-nitrobenzaldehyde (CAS 20041-61-6) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 2-hydroxy-3-methoxy-4-nitrobenzaldehyde. InChIKey: PAQVXXZKNYZUOH-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 2-hydroxy-3-methoxy-4-nitrobenzaldehyde |
| InChIKey | PAQVXXZKNYZUOH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1O)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)