Products 2005-08-5
CAS 2005-08-5 appears in our catalog under these names: 4-Chlorophenyl Benzoate, 4–Chlorophenyl Benzoate, 4-Chlorophenyl Benzoate, >99.0%(GC), 4-Chlorophenyl benzoate 97%, 4-Chlorophenyl Benzoate, 97%, 97%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 2,5g, 25g, 5g, 1g.
(4-chlorophenyl) benzoate (CAS 2005-08-5) is a chemical compound with the molecular formula C13H9ClO2 and a molecular weight of 232.66 g/mol. IUPAC name: (4-chlorophenyl) benzoate. InChIKey: JKSIXXOEIXUYFW-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | (4-chlorophenyl) benzoate |
| InChIKey | JKSIXXOEIXUYFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)