CAS 2007915-44-6 is the registry number for tert-butyl N-(cis-2-methylazetidin-3-yl)carbamate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 10g.
Tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate;hydrochloride (CAS 2007915-44-6) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate;hydrochloride. InChIKey: QEGLJGQQFDDFJO-ZJLYAJKPSA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | tert-butyl N-[(2R,3R)-2-methylazetidin-3-yl]carbamate;hydrochloride |
| InChIKey | QEGLJGQQFDDFJO-ZJLYAJKPSA-N |
| SMILES | C[C@@H]1[C@@H](CN1)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)