Products 2227205-00-5

CAS 2227205-00-5 is the registry number for tert-butyl N-(2-methylazetidin-3-yl)carbamate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2-methylazetidin-3-yl)carbamate;hydrochloride (CAS 2227205-00-5) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-(2-methylazetidin-3-yl)carbamate;hydrochloride. InChIKey: QEGLJGQQFDDFJO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19ClN2O2
Molecular weight222.71 g/mol
IUPAC nametert-butyl N-(2-methylazetidin-3-yl)carbamate;hydrochloride
InChIKeyQEGLJGQQFDDFJO-UHFFFAOYSA-N
SMILESCC1C(CN1)NC(=O)OC(C)(C)C.Cl

Computed by PubChem (NCBI)