Products 2007916-63-2
CAS 2007916-63-2 appears in our catalog under these names: 8-Bromo-1,5-naphthyridine-3-carboxylic acid, 95%, 95%, 8-BROMO-1,5-NAPHTHYRIDINE-3-CARBOXYLIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
8-bromo-1,5-naphthyridine-3-carboxylic acid (CAS 2007916-63-2) is a chemical compound with the molecular formula C9H5BrN2O2 and a molecular weight of 253.05 g/mol. IUPAC name: 8-bromo-1,5-naphthyridine-3-carboxylic acid. InChIKey: DERFPWWIVWOJBT-UHFFFAOYSA-N.
| Molecular formula | C9H5BrN2O2 |
|---|---|
| Molecular weight | 253.05 g/mol |
| IUPAC name | 8-bromo-1,5-naphthyridine-3-carboxylic acid |
| InChIKey | DERFPWWIVWOJBT-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C=NC2=C1Br)C(=O)O |
Computed by PubChem (NCBI)