CAS 2007916-75-6 appears in our catalog under these names: 8-Chloro-1,5-naphthyridine-3-carboxylic acid, 95%, 8-Chloro-1,5-naphthyridine-3-carboxylic acid, 95%, 95%, 8-CHLORO-1,5-NAPHTHYRIDINE-3-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
8-chloro-1,5-naphthyridine-3-carboxylic acid (CAS 2007916-75-6) is a chemical compound with the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. IUPAC name: 8-chloro-1,5-naphthyridine-3-carboxylic acid. InChIKey: QXSDCSFLTHGMGR-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O2 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 8-chloro-1,5-naphthyridine-3-carboxylic acid |
| InChIKey | QXSDCSFLTHGMGR-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C=C(C=NC2=C1Cl)C(=O)O |
Computed by PubChem (NCBI)