CAS 2007920-59-2 is the registry number for 7-Chloro-1,5-naphthyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-chloro-1,5-naphthyridin-3-amine (CAS 2007920-59-2) is a chemical compound with the molecular formula C8H6ClN3 and a molecular weight of 179.60 g/mol. IUPAC name: 7-chloro-1,5-naphthyridin-3-amine. InChIKey: NBBJOBJJXADIQW-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3 |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 7-chloro-1,5-naphthyridin-3-amine |
| InChIKey | NBBJOBJJXADIQW-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=CC(=C2)Cl)N |
Computed by PubChem (NCBI)