CAS 200956-14-5 appears in our catalog under these names: 2-Bromo-4-(trifluoromethoxy)anisole, 2-Bromo-1-methoxy-4-(trifluoromethoxy)benzene, ≥95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 2,5g, 1g, 5g.
2-bromo-1-methoxy-4-(trifluoromethoxy)benzene (CAS 200956-14-5) is a chemical compound with the molecular formula C8H6BrF3O2 and a molecular weight of 271.03 g/mol. IUPAC name: 2-bromo-1-methoxy-4-(trifluoromethoxy)benzene. InChIKey: NLXLUYVVEOZWNB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2 |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | 2-bromo-1-methoxy-4-(trifluoromethoxy)benzene |
| InChIKey | NLXLUYVVEOZWNB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)