Products 20107-13-5
CAS 20107-13-5 is the registry number for Cis-methylkhellactone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
(9R,10R)-9-hydroxy-10-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one (CAS 20107-13-5) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: (9R,10R)-9-hydroxy-10-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one. InChIKey: MDDPVXHWOABQJQ-ZIAGYGMSSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | (9R,10R)-9-hydroxy-10-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
| InChIKey | MDDPVXHWOABQJQ-ZIAGYGMSSA-N |
| SMILES | CC1([C@@H]([C@@H](C2=C(O1)C=CC3=C2OC(=O)C=C3)OC)O)C |
Computed by PubChem (NCBI)
Synonyms:
cis-Methylkhellactone, orb1682934