CAS 23733-92-8 is the registry number for trans-Methylkhellactone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(9R,10S)-9-hydroxy-10-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one (CAS 23733-92-8) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: (9R,10S)-9-hydroxy-10-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one. InChIKey: MDDPVXHWOABQJQ-UONOGXRCSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | (9R,10S)-9-hydroxy-10-methoxy-8,8-dimethyl-9,10-dihydropyrano[2,3-f]chromen-2-one |
| InChIKey | MDDPVXHWOABQJQ-UONOGXRCSA-N |
| SMILES | CC1([C@@H]([C@H](C2=C(O1)C=CC3=C2OC(=O)C=C3)OC)O)C |
Computed by PubChem (NCBI)