CAS 2012-78-4 appears in our catalog under these names: 2-(2,6-Dichlorophenyl)propanoic acid, 95%, 2-(2,6-Dichlorophenyl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-(2,6-dichlorophenyl)propanoic acid (CAS 2012-78-4) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)propanoic acid. InChIKey: RKKDBMSOQDOIRB-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)propanoic acid |
| InChIKey | RKKDBMSOQDOIRB-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)