CAS 201298-39-7 appears in our catalog under these names: 7-Chloro-3-methyl-3,4-dihydroquinazolin-4-one, 95%, 7-Chloro-3-methyl-3,4-dihydroquinazolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
7-chloro-3-methylquinazolin-4-one (CAS 201298-39-7) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 7-chloro-3-methylquinazolin-4-one. InChIKey: YFXSFYHESBVHQR-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 7-chloro-3-methylquinazolin-4-one |
| InChIKey | YFXSFYHESBVHQR-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C(C1=O)C=CC(=C2)Cl |
Computed by PubChem (NCBI)