CAS 2013537-81-8 appears in our catalog under these names: 1αH,5αH–Guaia–6–ene–4β,10β–diol, 1αH,5αH-guaia-6-ene-4β,10β-diol, ≥95%, ≥95%, 1αH,5αH-Guaia-6-ene-4β,10β-diol, 96.72%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 5 mg, 10 mg.
(1S,3aR,4S,8aR)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol (CAS 2013537-81-8) is a chemical compound with the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. IUPAC name: (1S,3aR,4S,8aR)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol. InChIKey: IWQURBSTAIRNAE-KBXIAJHMSA-N.
| Molecular formula | C15H26O2 |
|---|---|
| Molecular weight | 238.37 g/mol |
| IUPAC name | (1S,3aR,4S,8aR)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,8a-hexahydroazulene-1,4-diol |
| InChIKey | IWQURBSTAIRNAE-KBXIAJHMSA-N |
| SMILES | CC(C)C1=C[C@@H]2[C@@H](CC[C@]2(C)O)[C@@](CC1)(C)O |
Computed by PubChem (NCBI)