Products 20197-55-1
CAS 20197-55-1 is the registry number for 6,8-Dichloro-[1,3]dioxolo[4,5-G]quinazoline, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6,8-dichloro-[1,3]dioxolo[4,5-g]quinazoline (CAS 20197-55-1) is a chemical compound with the molecular formula C9H4Cl2N2O2 and a molecular weight of 243.04 g/mol. IUPAC name: 6,8-dichloro-[1,3]dioxolo[4,5-g]quinazoline. InChIKey: FDXFQHNKDXERIJ-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2N2O2 |
|---|---|
| Molecular weight | 243.04 g/mol |
| IUPAC name | 6,8-dichloro-[1,3]dioxolo[4,5-g]quinazoline |
| InChIKey | FDXFQHNKDXERIJ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)