CAS 20201-03-0 appears in our catalog under these names: 2-Chloro-4-nitrobenzene-1-sulfonyl chloride 95%, 2-Chloro-4-nitrobenzenesulfonyl chloride, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
2-chloro-4-nitrobenzenesulfonyl chloride (CAS 20201-03-0) is a chemical compound with the molecular formula C6H3Cl2NO4S and a molecular weight of 256.06 g/mol. IUPAC name: 2-chloro-4-nitrobenzenesulfonyl chloride. InChIKey: QWNVNPSFHISUID-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO4S |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 2-chloro-4-nitrobenzenesulfonyl chloride |
| InChIKey | QWNVNPSFHISUID-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)