Products 20201-03-0

CAS 20201-03-0 appears in our catalog under these names: 2-Chloro-4-nitrobenzene-1-sulfonyl chloride 95%, 2-Chloro-4-nitrobenzenesulfonyl chloride, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-chloro-4-nitrobenzenesulfonyl chloride (CAS 20201-03-0) is a chemical compound with the molecular formula C6H3Cl2NO4S and a molecular weight of 256.06 g/mol. IUPAC name: 2-chloro-4-nitrobenzenesulfonyl chloride. InChIKey: QWNVNPSFHISUID-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl2NO4S
Molecular weight256.06 g/mol
IUPAC name2-chloro-4-nitrobenzenesulfonyl chloride
InChIKeyQWNVNPSFHISUID-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1[N+](=O)[O-])Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)