CAS 97-08-5 appears in our catalog under these names: 4-Chloro-3-nitrobenzenesulfonyl chloride, 98% , 4-Chloro-3-nitrobenzenesulfonyl Chloride, >96.0%(GC)(T), 4-Chloro-3-nitrobenzenesulfonyl Chloride 95%, 4-Chloro-3-nitrobenzene-1-sulfonyl chloride, 95%. Offered by: Thermo Scientific (Alfa Aesar), TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g, 10g, 500g.
4-chloro-3-nitrobenzenesulfonyl chloride (CAS 97-08-5) is a chemical compound with the molecular formula C6H3Cl2NO4S and a molecular weight of 256.06 g/mol. IUPAC name: 4-chloro-3-nitrobenzenesulfonyl chloride. InChIKey: SEWNAJIUKSTYOP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO4S |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 4-chloro-3-nitrobenzenesulfonyl chloride |
| InChIKey | SEWNAJIUKSTYOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)