Products 476156-65-7
CAS 476156-65-7 is the registry number for 2-Chloro-5-(chlorosulfonyl)nicotinic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-chloro-5-chlorosulfonylpyridine-3-carboxylic acid (CAS 476156-65-7) is a chemical compound with the molecular formula C6H3Cl2NO4S and a molecular weight of 256.06 g/mol. IUPAC name: 2-chloro-5-chlorosulfonylpyridine-3-carboxylic acid. InChIKey: LZTZZRPMYAKSFU-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO4S |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 2-chloro-5-chlorosulfonylpyridine-3-carboxylic acid |
| InChIKey | LZTZZRPMYAKSFU-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)