Products 21792-87-0

CAS 21792-87-0 appears in our catalog under these names: 5-Chloro-2-nitrobenzenesulfonyl chloride, 95%, 5-Chloro-2-nitrobenzenesulfonyl chloride, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 25g.

Structural formula: {0} (CAS {1})

5-chloro-2-nitrobenzenesulfonyl chloride (CAS 21792-87-0) is a chemical compound with the molecular formula C6H3Cl2NO4S and a molecular weight of 256.06 g/mol. IUPAC name: 5-chloro-2-nitrobenzenesulfonyl chloride. InChIKey: LNNFIOQFBJVJMZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl2NO4S
Molecular weight256.06 g/mol
IUPAC name5-chloro-2-nitrobenzenesulfonyl chloride
InChIKeyLNNFIOQFBJVJMZ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)S(=O)(=O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)