Products 78846-40-9

CAS 78846-40-9 appears in our catalog under these names: 3-Chloro-2-nitrobenzenesulfonyl chloride, 95%, 3-Chloro-2-nitrobenzenesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg.

3-chloro-2-nitrobenzenesulfonyl chloride (CAS 78846-40-9) is a chemical compound with the molecular formula C6H3Cl2NO4S and a molecular weight of 256.06 g/mol. IUPAC name: 3-chloro-2-nitrobenzenesulfonyl chloride. InChIKey: ADOXIPNKUNIZFV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3Cl2NO4S
Molecular weight256.06 g/mol
IUPAC name3-chloro-2-nitrobenzenesulfonyl chloride
InChIKeyADOXIPNKUNIZFV-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)[N+](=O)[O-])S(=O)(=O)Cl

Computed by PubChem (NCBI)