CAS 20217-01-0 appears in our catalog under these names: 2,4-Dibromophenyl Glycidyl Ether, 90% GC, 2,4-Dibromophenyl Glycidyl Ether, 2-((2,4-Dibromophenoxy)methyl)oxirane, 90%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 500g, 5g.
2-[(2,4-dibromophenoxy)methyl]oxirane (CAS 20217-01-0) is a chemical compound with the molecular formula C9H8Br2O2 and a molecular weight of 307.97 g/mol. IUPAC name: 2-[(2,4-dibromophenoxy)methyl]oxirane. InChIKey: NFWLWLQSZIJYFR-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2O2 |
|---|---|
| Molecular weight | 307.97 g/mol |
| IUPAC name | 2-[(2,4-dibromophenoxy)methyl]oxirane |
| InChIKey | NFWLWLQSZIJYFR-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC2=C(C=C(C=C2)Br)Br |
Computed by PubChem (NCBI)