Products 20217-22-5
CAS 20217-22-5 appears in our catalog under these names: COH1, COH1, 99.25%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 5 mg, 25 mg, 10 mg, 100 mg.
N-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]acetamide (CAS 20217-22-5) is a chemical compound with the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. IUPAC name: N-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]acetamide. InChIKey: URUUPFDMCFXHGD-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | N-[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]acetamide |
| InChIKey | URUUPFDMCFXHGD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC(=CS1)C2=CC(=C(C=C2)O)O |
Computed by PubChem (NCBI)