Products 202190-49-6
CAS 202190-49-6 is the registry number for Choline-13C2 (chloride), 98.0%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.
2-hydroxy(1,2-13C2)ethyl(trimethyl)azanium chloride (CAS 202190-49-6) is a chemical compound with the molecular formula C5H14ClNO and a molecular weight of 141.61 g/mol. IUPAC name: 2-hydroxy(1,2-13C2)ethyl(trimethyl)azanium chloride. InChIKey: SGMZJAMFUVOLNK-BIZAMFJHSA-M.
| Molecular formula | C5H14ClNO |
|---|---|
| Molecular weight | 141.61 g/mol |
| IUPAC name | 2-hydroxy(1,2-13C2)ethyl(trimethyl)azanium chloride |
| InChIKey | SGMZJAMFUVOLNK-BIZAMFJHSA-M |
| SMILES | C[N+](C)(C)[13CH2][13CH2]O.[Cl-] |
Computed by PubChem (NCBI)