Products 352438-97-2
CAS 352438-97-2 appears in our catalog under these names: Choline-d13 Chloride (N,N,N-trimethyl-d9, 1,1,2,2-d4), >95% (HPLC), Choline-d13 Chloride (N,N,N-trimethyl-d9, 1,1,2,2-d4), 98 atom % D, min 98% Chemical Purity, Choline–d13 chloride, Choline-d13 (chloride), 99.90%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 5mg, 1 mg, 10 mg.
(1,1,2,2-tetradeuterio-2-hydroxyethyl)-tris(trideuteriomethyl)azanium chloride (CAS 352438-97-2) is a chemical compound with the molecular formula C5H14ClNO and a molecular weight of 152.70 g/mol. IUPAC name: (1,1,2,2-tetradeuterio-2-hydroxyethyl)-tris(trideuteriomethyl)azanium chloride. InChIKey: SGMZJAMFUVOLNK-TYBPHYHNSA-M.
| Molecular formula | C5H14ClNO |
|---|---|
| Molecular weight | 152.70 g/mol |
| IUPAC name | (1,1,2,2-tetradeuterio-2-hydroxyethyl)-tris(trideuteriomethyl)azanium chloride |
| InChIKey | SGMZJAMFUVOLNK-TYBPHYHNSA-M |
| SMILES | [2H]C([2H])([2H])[N+](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])O.[Cl-] |
Computed by PubChem (NCBI)