Products 3035513-80-2

CAS 3035513-80-2 is the registry number for Choline-d6 Chloride (N,N-dimethyl-d6), 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.

Structural formula: {0} (CAS {1})

2-hydroxyethyl-methyl-bis(trideuteriomethyl)azanium chloride (CAS 3035513-80-2) is a chemical compound with the molecular formula C5H14ClNO and a molecular weight of 145.66 g/mol. IUPAC name: 2-hydroxyethyl-methyl-bis(trideuteriomethyl)azanium chloride. InChIKey: SGMZJAMFUVOLNK-TXHXQZCNSA-M.

Identity
Molecular formulaC5H14ClNO
Molecular weight145.66 g/mol
IUPAC name2-hydroxyethyl-methyl-bis(trideuteriomethyl)azanium chloride
InChIKeySGMZJAMFUVOLNK-TXHXQZCNSA-M
SMILES[2H]C([2H])([2H])[N+](C)(CCO)C([2H])([2H])[2H].[Cl-]

Computed by PubChem (NCBI)